C14H17Cl2NO — CID 114179159
3-(2,4-dichlorophenyl)-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine (PubChem CID 114179159) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine.
| Compound Name | 3-(2,4-dichlorophenyl)-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine |
|---|---|
| PubChem CID | 114179159 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine |
| SMILES | Clc1ccc(C2CNC3CCCC3CO2)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO/c15-10-4-5-11(12(16)6-10)14-7-17-13-3-1-2-9(13)8-18-14/h4-6,9,13-14,17H,1-3,7-8H2 |
| InChIKey | PKIXZCWUWIICTE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |