C9H6Cl2OS2 — CID 132535937
5-(2,4-dichlorophenyl)-1,3-oxathiolane-2-thione (PubChem CID 132535937) has the molecular formula C9H6Cl2OS2 and a molecular weight of 265.19 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-1,3-oxathiolane-2-thione.
| Compound Name | 5-(2,4-dichlorophenyl)-1,3-oxathiolane-2-thione |
|---|---|
| PubChem CID | 132535937 |
| Molecular Formula | C9H6Cl2OS2 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 263.92 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-1,3-oxathiolane-2-thione |
| SMILES | S=C1OC(c2ccc(Cl)cc2Cl)CS1 |
| InChI | InChI=1S/C9H6Cl2OS2/c10-5-1-2-6(7(11)3-5)8-4-14-9(13)12-8/h1-3,8H,4H2 |
| InChIKey | CBSGJDVZGUKFPQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|