C16H10Cl4N4S2 — CID 3443240
1,5-bis(2,4-dichlorophenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione (PubChem CID 3443240) has the molecular formula C16H10Cl4N4S2 and a molecular weight of 464.23 g/mol. Its IUPAC name is 1,5-bis(2,4-dichlorophenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione.
| Compound Name | 1,5-bis(2,4-dichlorophenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
|---|---|
| PubChem CID | 3443240 |
| Molecular Formula | C16H10Cl4N4S2 |
| Molecular Weight | 464.23 g/mol |
| Exact Mass | 461.91 |
| IUPAC Name | 1,5-bis(2,4-dichlorophenyl)-1,2,5,6-tetrahydro-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithione |
| SMILES | S=C1NC(c2ccc(Cl)cc2Cl)N2C(=S)NC(c3ccc(Cl)cc3Cl)N12 |
| InChI | InChI=1S/C16H10Cl4N4S2/c17-7-1-3-9(11(19)5-7)13-21-15(25)24-14(22-16(26)23(13)24)10-4-2-8(18)6-12(10)20/h1-6,13-14H,(H,21,25)(H,22,26) |
| InChIKey | MAJJHKZWILAELO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.23 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|