C9H10ClNO — CID 15261641
5-(3-chlorophenyl)-1,3-oxazolidine (PubChem CID 15261641) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-1,3-oxazolidine.
| Compound Name | 5-(3-chlorophenyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 15261641 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 5-(3-chlorophenyl)-1,3-oxazolidine |
| SMILES | Clc1cccc(C2CNCO2)c1 |
| InChI | InChI=1S/C9H10ClNO/c10-8-3-1-2-7(4-8)9-5-11-6-12-9/h1-4,9,11H,5-6H2 |
| InChIKey | WNMHKMPNNZJBTH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |