C14H20ClNO — CID 114177417
2-(3-chlorophenyl)-5-propan-2-yl-1,4-oxazepane (PubChem CID 114177417) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-propan-2-yl-1,4-oxazepane.
| Compound Name | 2-(3-chlorophenyl)-5-propan-2-yl-1,4-oxazepane |
|---|---|
| PubChem CID | 114177417 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-(3-chlorophenyl)-5-propan-2-yl-1,4-oxazepane |
| SMILES | CC(C)C1CCOC(c2cccc(Cl)c2)CN1 |
| InChI | InChI=1S/C14H20ClNO/c1-10(2)13-6-7-17-14(9-16-13)11-4-3-5-12(15)8-11/h3-5,8,10,13-14,16H,6-7,9H2,1-2H3 |
| InChIKey | GNLBRSWDHUCISP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |