C10H12ClNO — CID 82282088
2-(3-chlorophenyl)-5-methyl-1,3-oxazolidine (PubChem CID 82282088) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-methyl-1,3-oxazolidine.
| Compound Name | 2-(3-chlorophenyl)-5-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 82282088 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 2-(3-chlorophenyl)-5-methyl-1,3-oxazolidine |
| SMILES | CC1CNC(c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C10H12ClNO/c1-7-6-12-10(13-7)8-3-2-4-9(11)5-8/h2-5,7,10,12H,6H2,1H3 |
| InChIKey | NKXMKWMEHBRJQT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |