C13H16ClNO — CID 10082891
(2S,3aS,7aR)-2-(3-chlorophenyl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazole (PubChem CID 10082891) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is (2S,3aS,7aR)-2-(3-chlorophenyl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazole.
| Compound Name | (2S,3aS,7aR)-2-(3-chlorophenyl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 10082891 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (2S,3aS,7aR)-2-(3-chlorophenyl)-2,3,3a,4,5,6,7,7a-octahydro-1,3-benzoxazole |
| SMILES | Clc1cccc([C@H]2N[C@H]3CCCC[C@H]3O2)c1 |
| InChI | InChI=1S/C13H16ClNO/c14-10-5-3-4-9(8-10)13-15-11-6-1-2-7-12(11)16-13/h3-5,8,11-13,15H,1-2,6-7H2/t11-,12+,13-/m0/s1 |
| InChIKey | VPJKJBLCXYMYLM-XQQFMLRXSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |