C14H18ClNO2 — CID 11065421
(2S,4aR,8aR)-2-(3-chlorophenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-4a-ol (PubChem CID 11065421) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (2S,4aR,8aR)-2-(3-chlorophenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-4a-ol.
| Compound Name | (2S,4aR,8aR)-2-(3-chlorophenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-4a-ol |
|---|---|
| PubChem CID | 11065421 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (2S,4aR,8aR)-2-(3-chlorophenyl)-2,3,4,5,6,7,8,8a-octahydrobenzo[e][1,3]oxazin-4a-ol |
| SMILES | O[C@@]12CCCC[C@H]1O[C@@H](c1cccc(Cl)c1)NC2 |
| InChI | InChI=1S/C14H18ClNO2/c15-11-5-3-4-10(8-11)13-16-9-14(17)7-2-1-6-12(14)18-13/h3-5,8,12-13,16-17H,1-2,6-7,9H2/t12-,13+,14-/m1/s1 |
| InChIKey | PYNHJGIFTCWSCS-HZSPNIEDSA-N |
| XLogP | 2.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |