C20H20ClNO — CID 15717131
(4S,4aR,8aR)-2-(3-chlorophenyl)-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazine (PubChem CID 15717131) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is (4S,4aR,8aR)-2-(3-chlorophenyl)-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazine.
| Compound Name | (4S,4aR,8aR)-2-(3-chlorophenyl)-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazine |
|---|---|
| PubChem CID | 15717131 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (4S,4aR,8aR)-2-(3-chlorophenyl)-4-phenyl-4a,5,6,7,8,8a-hexahydro-4H-1,3-benzoxazine |
| SMILES | Clc1cccc(C2=N[C@H](c3ccccc3)[C@H]3CCCC[C@H]3O2)c1 |
| InChI | InChI=1S/C20H20ClNO/c21-16-10-6-9-15(13-16)20-22-19(14-7-2-1-3-8-14)17-11-4-5-12-18(17)23-20/h1-3,6-10,13,17-19H,4-5,11-12H2/t17-,18+,19+/m0/s1 |
| InChIKey | NITSBWZWYDMVAH-IPMKNSEASA-N |
| XLogP | 5.42 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |