C16H13BrClNO — CID 102142867
(4R,5R)-5-bromo-2-(4-chlorophenyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 102142867) has the molecular formula C16H13BrClNO and a molecular weight of 350.64 g/mol. Its IUPAC name is (4R,5R)-5-bromo-2-(4-chlorophenyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | (4R,5R)-5-bromo-2-(4-chlorophenyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 102142867 |
| Molecular Formula | C16H13BrClNO |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (4R,5R)-5-bromo-2-(4-chlorophenyl)-4-phenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | Clc1ccc(C2=N[C@H](c3ccccc3)[C@@H](Br)CO2)cc1 |
| InChI | InChI=1S/C16H13BrClNO/c17-14-10-20-16(12-6-8-13(18)9-7-12)19-15(14)11-4-2-1-3-5-11/h1-9,14-15H,10H2/t14-,15+/m0/s1 |
| InChIKey | AIQFRRQBIADTDX-LSDHHAIUSA-N |
| XLogP | 4.62 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|