C27H21NO — CID 102576068
(4R,5R)-4,5-diphenyl-2-(4-phenylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 102576068) has the molecular formula C27H21NO and a molecular weight of 375.47 g/mol. Its IUPAC name is (4R,5R)-4,5-diphenyl-2-(4-phenylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5R)-4,5-diphenyl-2-(4-phenylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102576068 |
| Molecular Formula | C27H21NO |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (4R,5R)-4,5-diphenyl-2-(4-phenylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(-c2ccc(C3=N[C@H](c4ccccc4)[C@@H](c4ccccc4)O3)cc2)cc1 |
| InChI | InChI=1S/C27H21NO/c1-4-10-20(11-5-1)21-16-18-24(19-17-21)27-28-25(22-12-6-2-7-13-22)26(29-27)23-14-8-3-9-15-23/h1-19,25-26H/t25-,26-/m1/s1 |
| InChIKey | ZBDSDVZGGNGQEV-CLJLJLNGSA-N |
| XLogP | 6.61 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |