C16H15NO2 — CID 15259255
[(4S,5S)-2,5-diphenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol (PubChem CID 15259255) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is [(4S,5S)-2,5-diphenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol.
| Compound Name | [(4S,5S)-2,5-diphenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 15259255 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [(4S,5S)-2,5-diphenyl-4,5-dihydro-1,3-oxazol-4-yl]methanol |
| SMILES | OC[C@@H]1N=C(c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H15NO2/c18-11-14-15(12-7-3-1-4-8-12)19-16(17-14)13-9-5-2-6-10-13/h1-10,14-15,18H,11H2/t14-,15-/m0/s1 |
| InChIKey | ARLAZZQDTBOFOL-GJZGRUSLSA-N |
| XLogP | 2.57 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |