C22H19NO2 — CID 102576070
(4R,5R)-2-(3-methoxyphenyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole (PubChem CID 102576070) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (4R,5R)-2-(3-methoxyphenyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5R)-2-(3-methoxyphenyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102576070 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (4R,5R)-2-(3-methoxyphenyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| SMILES | COc1cccc(C2=N[C@H](c3ccccc3)[C@@H](c3ccccc3)O2)c1 |
| InChI | InChI=1S/C22H19NO2/c1-24-19-14-8-13-18(15-19)22-23-20(16-9-4-2-5-10-16)21(25-22)17-11-6-3-7-12-17/h2-15,20-21H,1H3/t20-,21-/m1/s1 |
| InChIKey | GJOHKDUJMLYCGA-NHCUHLMSSA-N |
| XLogP | 4.95 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |