C13H14BrNO2 — CID 135045110
(4S,5S)-5-(bromomethyl)-4-ethenyl-2-(3-methoxyphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 135045110) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is (4S,5S)-5-(bromomethyl)-4-ethenyl-2-(3-methoxyphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5S)-5-(bromomethyl)-4-ethenyl-2-(3-methoxyphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135045110 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (4S,5S)-5-(bromomethyl)-4-ethenyl-2-(3-methoxyphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | C=C[C@@H]1N=C(c2cccc(OC)c2)O[C@@H]1CBr |
| InChI | InChI=1S/C13H14BrNO2/c1-3-11-12(8-14)17-13(15-11)9-5-4-6-10(7-9)16-2/h3-7,11-12H,1,8H2,2H3/t11-,12+/m0/s1 |
| InChIKey | NARPJCGPMIGPHU-NWDGAFQWSA-N |
| XLogP | 2.79 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|