C21H16FNO — CID 44550907
(4R,5R)-2-(4-fluorophenyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole (PubChem CID 44550907) has the molecular formula C21H16FNO and a molecular weight of 317.36 g/mol. Its IUPAC name is (4R,5R)-2-(4-fluorophenyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5R)-2-(4-fluorophenyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 44550907 |
| Molecular Formula | C21H16FNO |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (4R,5R)-2-(4-fluorophenyl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1ccc(C2=N[C@H](c3ccccc3)[C@@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C21H16FNO/c22-18-13-11-17(12-14-18)21-23-19(15-7-3-1-4-8-15)20(24-21)16-9-5-2-6-10-16/h1-14,19-20H/t19-,20-/m1/s1 |
| InChIKey | ITXFSWBECHHXRY-WOJBJXKFSA-N |
| XLogP | 5.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |