C17H16N2O2 — CID 25010935
N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide (PubChem CID 25010935) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 25010935 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=N[C@H](c3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C17H16N2O2/c1-12(20)18-15-9-7-14(8-10-15)17-19-16(11-21-17)13-5-3-2-4-6-13/h2-10,16H,11H2,1H3,(H,18,20)/t16-/m0/s1 |
| InChIKey | CORHGWBOIMDSEN-INIZCTEOSA-N |
| XLogP | 3.16 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |