About N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide
N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide (PubChem CID 25010935) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide |
| PubChem CID | 25010935 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=N[C@H](c3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C17H16N2O2/c1-12(20)18-15-9-7-14(8-10-15)17-19-16(11-21-17)13-5-3-2-4-6-13/h2-10,16H,11H2,1H3,(H,18,20)/t16-/m0/s1 |
| InChIKey | CORHGWBOIMDSEN-INIZCTEOSA-N |
| XLogP | 3.16 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide?
The IUPAC name of N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide (CID 25010935) is N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide?
The canonical SMILES for N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide is CC(=O)Nc1ccc(C2=N[C@H](c3ccccc3)CO2)cc1.
What is the InChIKey of N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide?
The InChIKey is CORHGWBOIMDSEN-INIZCTEOSA-N. The full InChI is InChI=1S/C17H16N2O2/c1-12(20)18-15-9-7-14(8-10-15)17-19-16(11-21-17)13-5-3-2-4-6-13/h2-10,16H,11H2,1H3,(H,18,20)/t16-/m0/s1.
What are the key properties of N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide?
N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide has a molecular weight of 280.33 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(4R)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]acetamide is sourced from PubChem (CID 25010935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).