C14H17NO — CID 10584792
2-phenyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3]oxazole (PubChem CID 10584792) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-phenyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3]oxazole.
| Compound Name | 2-phenyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3]oxazole |
|---|---|
| PubChem CID | 10584792 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-phenyl-4,5,6,7,8,8a-hexahydro-3aH-cyclohepta[d][1,3]oxazole |
| SMILES | c1ccc(C2=NC3CCCCCC3O2)cc1 |
| InChI | InChI=1S/C14H17NO/c1-3-7-11(8-4-1)14-15-12-9-5-2-6-10-13(12)16-14/h1,3-4,7-8,12-13H,2,5-6,9-10H2 |
| InChIKey | YUMPZOJZBCUIDT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |