C9H7F2NO — CID 101174791
4,5-difluoro-2-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 101174791) has the molecular formula C9H7F2NO and a molecular weight of 183.16 g/mol. Its IUPAC name is 4,5-difluoro-2-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4,5-difluoro-2-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 101174791 |
| Molecular Formula | C9H7F2NO |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4,5-difluoro-2-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | FC1N=C(c2ccccc2)OC1F |
| InChI | InChI=1S/C9H7F2NO/c10-7-8(11)13-9(12-7)6-4-2-1-3-5-6/h1-5,7-8H |
| InChIKey | SIIISOYCTFOBHH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|