C9H9NO2 — CID 135011554
2-phenyl-4,5-dihydro-1,3-oxazol-5-ol (PubChem CID 135011554) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-phenyl-4,5-dihydro-1,3-oxazol-5-ol.
| Compound Name | 2-phenyl-4,5-dihydro-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 135011554 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2-phenyl-4,5-dihydro-1,3-oxazol-5-ol |
| SMILES | OC1CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C9H9NO2/c11-8-6-10-9(12-8)7-4-2-1-3-5-7/h1-5,8,11H,6H2 |
| InChIKey | SCEPQMQINSNIMP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |