C15H21NO — CID 5102402
6-butyl-5-methyl-2-phenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 5102402) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 6-butyl-5-methyl-2-phenyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | 6-butyl-5-methyl-2-phenyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 5102402 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 6-butyl-5-methyl-2-phenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | CCCCC1OC(c2ccccc2)=NCC1C |
| InChI | InChI=1S/C15H21NO/c1-3-4-10-14-12(2)11-16-15(17-14)13-8-6-5-7-9-13/h5-9,12,14H,3-4,10-11H2,1-2H3 |
| InChIKey | DSTQSQCJIMTZAD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |