C14H17NO — CID 54769462
6-butyl-2-phenyl-4H-1,3-oxazine (PubChem CID 54769462) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-butyl-2-phenyl-4H-1,3-oxazine.
| Compound Name | 6-butyl-2-phenyl-4H-1,3-oxazine |
|---|---|
| PubChem CID | 54769462 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 6-butyl-2-phenyl-4H-1,3-oxazine |
| SMILES | CCCCC1=CCN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C14H17NO/c1-2-3-9-13-10-11-15-14(16-13)12-7-5-4-6-8-12/h4-8,10H,2-3,9,11H2,1H3 |
| InChIKey | SWQVXNITAWNXCG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |