C18H27NO2 — CID 123819241
4-butyl-2-phenyl-4H-1,3-oxazol-5-one;pentane (PubChem CID 123819241) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-butyl-2-phenyl-4H-1,3-oxazol-5-one;pentane.
| Compound Name | 4-butyl-2-phenyl-4H-1,3-oxazol-5-one;pentane |
|---|---|
| PubChem CID | 123819241 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-butyl-2-phenyl-4H-1,3-oxazol-5-one;pentane |
| SMILES | CCCCC.CCCCC1N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C13H15NO2.C5H12/c1-2-3-9-11-13(15)16-12(14-11)10-7-5-4-6-8-10;1-3-5-4-2/h4-8,11H,2-3,9H2,1H3;3-5H2,1-2H3 |
| InChIKey | HYRASKDXTMZBHM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |