C18H23ClN2O2 — CID 9496808
2-(4-chlorophenyl)-4-(N-heptyl-C-methylcarbonimidoyl)-4H-1,3-oxazol-5-one (PubChem CID 9496808) has the molecular formula C18H23ClN2O2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(N-heptyl-C-methylcarbonimidoyl)-4H-1,3-oxazol-5-one.
| Compound Name | 2-(4-chlorophenyl)-4-(N-heptyl-C-methylcarbonimidoyl)-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 9496808 |
| Molecular Formula | C18H23ClN2O2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(N-heptyl-C-methylcarbonimidoyl)-4H-1,3-oxazol-5-one |
| SMILES | CCCCCCC/N=C(\C)C1N=C(c2ccc(Cl)cc2)OC1=O |
| InChI | InChI=1S/C18H23ClN2O2/c1-3-4-5-6-7-12-20-13(2)16-18(22)23-17(21-16)14-8-10-15(19)11-9-14/h8-11,16H,3-7,12H2,1-2H3/b20-13+ |
| InChIKey | IAHUYGAJBOWIIR-DEDYPNTBSA-N |
| XLogP | 4.44 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|