C17H21ClN2O2 — CID 7095289
2-(4-chlorophenyl)-4-(N-hexyl-C-methylcarbonimidoyl)-4H-1,3-oxazol-5-one (PubChem CID 7095289) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(N-hexyl-C-methylcarbonimidoyl)-4H-1,3-oxazol-5-one.
| Compound Name | 2-(4-chlorophenyl)-4-(N-hexyl-C-methylcarbonimidoyl)-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 7095289 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(N-hexyl-C-methylcarbonimidoyl)-4H-1,3-oxazol-5-one |
| SMILES | CCCCCC/N=C(\C)C1N=C(c2ccc(Cl)cc2)OC1=O |
| InChI | InChI=1S/C17H21ClN2O2/c1-3-4-5-6-11-19-12(2)15-17(21)22-16(20-15)13-7-9-14(18)10-8-13/h7-10,15H,3-6,11H2,1-2H3/b19-12+ |
| InChIKey | RXIGSTKXWRDTLM-XDHOZWIPSA-N |
| XLogP | 4.05 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|