C17H19ClN2O3 — CID 7466699
2-(4-chlorophenyl)-4-[C-methyl-N-[2-[(2S)-oxolan-2-yl]ethyl]carbonimidoyl]-4H-1,3-oxazol-5-one (PubChem CID 7466699) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[C-methyl-N-[2-[(2S)-oxolan-2-yl]ethyl]carbonimidoyl]-4H-1,3-oxazol-5-one.
| Compound Name | 2-(4-chlorophenyl)-4-[C-methyl-N-[2-[(2S)-oxolan-2-yl]ethyl]carbonimidoyl]-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 7466699 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[C-methyl-N-[2-[(2S)-oxolan-2-yl]ethyl]carbonimidoyl]-4H-1,3-oxazol-5-one |
| SMILES | C/C(=N\CC[C@@H]1CCCO1)C1N=C(c2ccc(Cl)cc2)OC1=O |
| InChI | InChI=1S/C17H19ClN2O3/c1-11(19-9-8-14-3-2-10-22-14)15-17(21)23-16(20-15)12-4-6-13(18)7-5-12/h4-7,14-15H,2-3,8-10H2,1H3/b19-11+/t14-,15?/m0/s1 |
| InChIKey | TTWOSXQAHUXBIT-YNLDCESNSA-N |
| XLogP | 3.04 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|