C18H24ClN3OS — CID 2718859
N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]nonanehydrazide (PubChem CID 2718859) has the molecular formula C18H24ClN3OS and a molecular weight of 365.93 g/mol. Its IUPAC name is N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]nonanehydrazide.
| Compound Name | N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]nonanehydrazide |
|---|---|
| PubChem CID | 2718859 |
| Molecular Formula | C18H24ClN3OS |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N'-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]nonanehydrazide |
| SMILES | CCCCCCCCC(=O)NNc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C18H24ClN3OS/c1-2-3-4-5-6-7-8-17(23)21-22-18-20-16(13-24-18)14-9-11-15(19)12-10-14/h9-13H,2-8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | PABWEMWAWJXBSF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|