C22H24ClN3OS — CID 3553749
N-[4-[2-(3-chloroanilino)-1,3-thiazol-4-yl]phenyl]heptanamide (PubChem CID 3553749) has the molecular formula C22H24ClN3OS and a molecular weight of 413.97 g/mol. Its IUPAC name is N-[4-[2-(3-chloroanilino)-1,3-thiazol-4-yl]phenyl]heptanamide.
| Compound Name | N-[4-[2-(3-chloroanilino)-1,3-thiazol-4-yl]phenyl]heptanamide |
|---|---|
| PubChem CID | 3553749 |
| Molecular Formula | C22H24ClN3OS |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[4-[2-(3-chloroanilino)-1,3-thiazol-4-yl]phenyl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc(-c2csc(Nc3cccc(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C22H24ClN3OS/c1-2-3-4-5-9-21(27)24-18-12-10-16(11-13-18)20-15-28-22(26-20)25-19-8-6-7-17(23)14-19/h6-8,10-15H,2-5,9H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | WSSSVBKZQJLOEV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|