C18H26ClN5O — CID 111554879
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-pentylguanidine (PubChem CID 111554879) has the molecular formula C18H26ClN5O and a molecular weight of 363.89 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-pentylguanidine.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-pentylguanidine |
|---|---|
| PubChem CID | 111554879 |
| Molecular Formula | C18H26ClN5O |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-pentylguanidine |
| SMILES | CCCCC/N=C(\NCC)NCCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C18H26ClN5O/c1-3-5-6-12-21-18(20-4-2)22-13-11-16-23-17(24-25-16)14-7-9-15(19)10-8-14/h7-10H,3-6,11-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | JPEZXAVRBSQCBI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|