C17H24ClN5O — CID 111612213
2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-pentylguanidine (PubChem CID 111612213) has the molecular formula C17H24ClN5O and a molecular weight of 349.87 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-pentylguanidine.
| Compound Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-pentylguanidine |
|---|---|
| PubChem CID | 111612213 |
| Molecular Formula | C17H24ClN5O |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-pentylguanidine |
| SMILES | CCCCCN/C(=N/Cc1nc(-c2ccc(Cl)cc2)no1)NCC |
| InChI | InChI=1S/C17H24ClN5O/c1-3-5-6-11-20-17(19-4-2)21-12-15-22-16(23-24-15)13-7-9-14(18)10-8-13/h7-10H,3-6,11-12H2,1-2H3,(H2,19,20,21) |
| InChIKey | XXTKQUITQQVRKC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|