C20H23ClIN5O2 — CID 111612105
2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111612105) has the molecular formula C20H23ClIN5O2 and a molecular weight of 527.79 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111612105 |
| Molecular Formula | C20H23ClIN5O2 |
| Molecular Weight | 527.79 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccc(Cl)cc2)no1)NCCOc1ccccc1.I |
| InChI | InChI=1S/C20H22ClN5O2.HI/c1-2-22-20(23-12-13-27-17-6-4-3-5-7-17)24-14-18-25-19(26-28-18)15-8-10-16(21)11-9-15;/h3-11H,2,12-14H2,1H3,(H2,22,23,24);1H |
| InChIKey | AHVAPTHDBJTPMW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|