C19H28ClN5O2 — CID 111612453
1-(3-butoxypropyl)-2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine (PubChem CID 111612453) has the molecular formula C19H28ClN5O2 and a molecular weight of 393.92 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine.
| Compound Name | 1-(3-butoxypropyl)-2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111612453 |
| Molecular Formula | C19H28ClN5O2 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-(3-butoxypropyl)-2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine |
| SMILES | CCCCOCCCN/C(=N/Cc1nc(-c2cccc(Cl)c2)no1)NCC |
| InChI | InChI=1S/C19H28ClN5O2/c1-3-5-11-26-12-7-10-22-19(21-4-2)23-14-17-24-18(25-27-17)15-8-6-9-16(20)13-15/h6,8-9,13H,3-5,7,10-12,14H2,1-2H3,(H2,21,22,23) |
| InChIKey | LFUOZMQIKSYSHI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|