C20H29ClN6O — CID 111791621
2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine (PubChem CID 111791621) has the molecular formula C20H29ClN6O and a molecular weight of 404.95 g/mol. Its IUPAC name is 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine.
| Compound Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 111791621 |
| Molecular Formula | C20H29ClN6O |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(1-propylpiperidin-4-yl)guanidine |
| SMILES | CCCN1CCC(N/C(=N/Cc2nc(-c3cccc(Cl)c3)no2)NCC)CC1 |
| InChI | InChI=1S/C20H29ClN6O/c1-3-10-27-11-8-17(9-12-27)24-20(22-4-2)23-14-18-25-19(26-28-18)15-6-5-7-16(21)13-15/h5-7,13,17H,3-4,8-12,14H2,1-2H3,(H2,22,23,24) |
| InChIKey | LYUUKNVHQGZMNH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|