C15H19ClIN5O — CID 119147941
2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-cyclopentylguanidine;hydroiodide (PubChem CID 119147941) has the molecular formula C15H19ClIN5O and a molecular weight of 447.71 g/mol. Its IUPAC name is 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-cyclopentylguanidine;hydroiodide.
| Compound Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-cyclopentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119147941 |
| Molecular Formula | C15H19ClIN5O |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-cyclopentylguanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1nc(-c2cccc(Cl)c2)no1)NC1CCCC1 |
| InChI | InChI=1S/C15H18ClN5O.HI/c16-11-5-3-4-10(8-11)14-20-13(22-21-14)9-18-15(17)19-12-6-1-2-7-12;/h3-5,8,12H,1-2,6-7,9H2,(H3,17,18,19);1H |
| InChIKey | NRMJCQHHJQCZQF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|