C18H24ClIN6O3 — CID 111814961
ethyl 4-[[N'-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111814961) has the molecular formula C18H24ClIN6O3 and a molecular weight of 534.79 g/mol. Its IUPAC name is ethyl 4-[[N'-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111814961 |
| Molecular Formula | C18H24ClIN6O3 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | ethyl 4-[[N'-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2nc(-c3cccc(Cl)c3)no2)CC1.I |
| InChI | InChI=1S/C18H23ClN6O3.HI/c1-2-27-18(26)25-8-6-14(7-9-25)22-17(20)21-11-15-23-16(24-28-15)12-4-3-5-13(19)10-12;/h3-5,10,14H,2,6-9,11H2,1H3,(H3,20,21,22);1H |
| InChIKey | MFSARKVAARCPSD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|