C20H22ClN5O — CID 111612637
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-2-[(4-methylphenyl)methyl]guanidine (PubChem CID 111612637) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-2-[(4-methylphenyl)methyl]guanidine.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-2-[(4-methylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111612637 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethyl-2-[(4-methylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1)NCc1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C20H22ClN5O/c1-3-22-20(23-12-15-9-7-14(2)8-10-15)24-13-18-25-19(26-27-18)16-5-4-6-17(21)11-16/h4-11H,3,12-13H2,1-2H3,(H2,22,23,24) |
| InChIKey | WOIFXLIJXPZTAP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|