C22H26ClN5O2 — CID 109411003
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine (PubChem CID 109411003) has the molecular formula C22H26ClN5O2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109411003 |
| Molecular Formula | C22H26ClN5O2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-(3-hydroxy-2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(CO)c1ccccc1)NCCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C22H26ClN5O2/c1-2-24-22(26-14-18(15-29)16-6-4-3-5-7-16)25-13-12-20-27-21(28-30-20)17-8-10-19(23)11-9-17/h3-11,18,29H,2,12-15H2,1H3,(H2,24,25,26) |
| InChIKey | WXEGQAKQOPSMND-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|