C19H17ClN2O3 — CID 6974427
2-(4-chlorophenyl)-4-[N-[(3-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-4H-1,3-oxazol-5-one (PubChem CID 6974427) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[N-[(3-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-4H-1,3-oxazol-5-one.
| Compound Name | 2-(4-chlorophenyl)-4-[N-[(3-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6974427 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[N-[(3-methoxyphenyl)methyl]-C-methylcarbonimidoyl]-4H-1,3-oxazol-5-one |
| SMILES | COc1cccc(C/N=C(\C)C2N=C(c3ccc(Cl)cc3)OC2=O)c1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-12(21-11-13-4-3-5-16(10-13)24-2)17-19(23)25-18(22-17)14-6-8-15(20)9-7-14/h3-10,17H,11H2,1-2H3/b21-12+ |
| InChIKey | CVPFSUQJJWKGDL-CIAFOILYSA-N |
| XLogP | 3.68 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|