bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid

C18H28N6O6S — CID 43810780

IUPACbis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid
SMILESCOc1cccc(CN=C(N)N)c1.COc1cccc(CN=C(N)N)c1.O=S(=O)(O)O
InChIInChI=1S/2C9H13N3O.H2O4S/c2*1-13-8-4-2-3-7(5-8)6-12-9(10)11;1-5(2,3)4/h2*2-5H,6H2,1H3,(H4,10,11,12);(H2,1,2,3,4)
InChIKeyRDRWQZZDCXHVCJ-UHFFFAOYSA-N
MW456.53 g/mol
LogP0.28
Rot. Bonds6

About bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid

bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid (PubChem CID 43810780) has the molecular formula C18H28N6O6S and a molecular weight of 456.53 g/mol. Its IUPAC name is bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid.

Molecular Properties

Compound Namebis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid
PubChem CID43810780
Molecular FormulaC18H28N6O6S
Molecular Weight456.53 g/mol
Exact Mass456.18
IUPAC Namebis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid
SMILESCOc1cccc(CN=C(N)N)c1.COc1cccc(CN=C(N)N)c1.O=S(=O)(O)O
InChIInChI=1S/2C9H13N3O.H2O4S/c2*1-13-8-4-2-3-7(5-8)6-12-9(10)11;1-5(2,3)4/h2*2-5H,6H2,1H3,(H4,10,11,12);(H2,1,2,3,4)
InChIKeyRDRWQZZDCXHVCJ-UHFFFAOYSA-N
XLogP0.28
TPSA221.86 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms31
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500456.53
LogP ≤ 50.28
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid?
The IUPAC name of bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid (CID 43810780) is bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid.
What is the SMILES notation for bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid?
The canonical SMILES for bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid is COc1cccc(CN=C(N)N)c1.COc1cccc(CN=C(N)N)c1.O=S(=O)(O)O.
What is the InChIKey of bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid?
The InChIKey is RDRWQZZDCXHVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H13N3O.H2O4S/c2*1-13-8-4-2-3-7(5-8)6-12-9(10)11;1-5(2,3)4/h2*2-5H,6H2,1H3,(H4,10,11,12);(H2,1,2,3,4).
What are the key properties of bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid?
bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid has a molecular weight of 456.53 g/mol, XLogP of 0.28, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[(3-methoxyphenyl)methyl]guanidine);sulfuric acid is sourced from PubChem (CID 43810780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).