C9H13NO4S — CID 112705076
(3-methoxyphenyl)methyl-methylsulfamic acid (PubChem CID 112705076) has the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl-methylsulfamic acid.
| Compound Name | (3-methoxyphenyl)methyl-methylsulfamic acid |
|---|---|
| PubChem CID | 112705076 |
| Molecular Formula | C9H13NO4S |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | (3-methoxyphenyl)methyl-methylsulfamic acid |
| SMILES | COc1cccc(CN(C)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C9H13NO4S/c1-10(15(11,12)13)7-8-4-3-5-9(6-8)14-2/h3-6H,7H2,1-2H3,(H,11,12,13) |
| InChIKey | SIWGVPCLUTTZLR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|