C13H21N3O3S — CID 66188280
N-[(3-methoxyphenyl)methyl-methylsulfamoyl]-N-methylazetidin-3-amine (PubChem CID 66188280) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl-methylsulfamoyl]-N-methylazetidin-3-amine.
| Compound Name | N-[(3-methoxyphenyl)methyl-methylsulfamoyl]-N-methylazetidin-3-amine |
|---|---|
| PubChem CID | 66188280 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl-methylsulfamoyl]-N-methylazetidin-3-amine |
| SMILES | COc1cccc(CN(C)S(=O)(=O)N(C)C2CNC2)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-15(10-11-5-4-6-13(7-11)19-3)20(17,18)16(2)12-8-14-9-12/h4-7,12,14H,8-10H2,1-3H3 |
| InChIKey | FVDWZRJHNCLXCZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |