C13H21N3O3S — CID 79685210
(3R)-3-[[(3-methoxyphenyl)methyl-methylsulfamoyl]amino]pyrrolidine (PubChem CID 79685210) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is (3R)-3-[[(3-methoxyphenyl)methyl-methylsulfamoyl]amino]pyrrolidine.
| Compound Name | (3R)-3-[[(3-methoxyphenyl)methyl-methylsulfamoyl]amino]pyrrolidine |
|---|---|
| PubChem CID | 79685210 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (3R)-3-[[(3-methoxyphenyl)methyl-methylsulfamoyl]amino]pyrrolidine |
| SMILES | COc1cccc(CN(C)S(=O)(=O)N[C@@H]2CCNC2)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-16(10-11-4-3-5-13(8-11)19-2)20(17,18)15-12-6-7-14-9-12/h3-5,8,12,14-15H,6-7,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | QMNSLYGNSTUQND-GFCCVEGCSA-N |
| XLogP | 0.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |