C14H20N2O5S — CID 71941905
1-[(3-methoxyphenyl)methyl-methylsulfamoyl]pyrrolidine-2-carboxylic acid (PubChem CID 71941905) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl-methylsulfamoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3-methoxyphenyl)methyl-methylsulfamoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 71941905 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl-methylsulfamoyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1cccc(CN(C)S(=O)(=O)N2CCCC2C(=O)O)c1 |
| InChI | InChI=1S/C14H20N2O5S/c1-15(10-11-5-3-6-12(9-11)21-2)22(19,20)16-8-4-7-13(16)14(17)18/h3,5-6,9,13H,4,7-8,10H2,1-2H3,(H,17,18) |
| InChIKey | ZNDFEPVORDSHGU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |