C23H33N5O2 — CID 91045030
2-[[3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]guanidine (PubChem CID 91045030) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[[3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]guanidine.
| Compound Name | 2-[[3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 91045030 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-[[3-[4-[4-(3-methoxyphenyl)piperazin-1-yl]butoxy]phenyl]methyl]guanidine |
| SMILES | COc1cccc(N2CCN(CCCCOc3cccc(CN=C(N)N)c3)CC2)c1 |
| InChI | InChI=1S/C23H33N5O2/c1-29-21-8-5-7-20(17-21)28-13-11-27(12-14-28)10-2-3-15-30-22-9-4-6-19(16-22)18-26-23(24)25/h4-9,16-17H,2-3,10-15,18H2,1H3,(H4,24,25,26) |
| InChIKey | QLUAGQNCFABBCW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|