C19H24N2O4 — CID 15572537
3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl furan-2-carboxylate (PubChem CID 15572537) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl furan-2-carboxylate.
| Compound Name | 3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl furan-2-carboxylate |
|---|---|
| PubChem CID | 15572537 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl furan-2-carboxylate |
| SMILES | COc1cccc(N2CCN(CCCOC(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C19H24N2O4/c1-23-17-6-2-5-16(15-17)21-11-9-20(10-12-21)8-4-14-25-19(22)18-7-3-13-24-18/h2-3,5-7,13,15H,4,8-12,14H2,1H3 |
| InChIKey | UZJJWUSWTWWZEX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|