C22H30N4OS — CID 25126004
[3-[5-(4-phenylpiperazin-1-yl)pentoxy]phenyl]thiourea (PubChem CID 25126004) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is [3-[5-(4-phenylpiperazin-1-yl)pentoxy]phenyl]thiourea.
| Compound Name | [3-[5-(4-phenylpiperazin-1-yl)pentoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 25126004 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [3-[5-(4-phenylpiperazin-1-yl)pentoxy]phenyl]thiourea |
| SMILES | NC(=S)Nc1cccc(OCCCCCN2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H30N4OS/c23-22(28)24-19-8-7-11-21(18-19)27-17-6-2-5-12-25-13-15-26(16-14-25)20-9-3-1-4-10-20/h1,3-4,7-11,18H,2,5-6,12-17H2,(H3,23,24,28) |
| InChIKey | ZHNQMMDJXLAOQD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|