C25H35FN4OS — CID 25126008
[3-[8-[4-(4-fluorophenyl)piperazin-1-yl]octoxy]phenyl]thiourea (PubChem CID 25126008) has the molecular formula C25H35FN4OS and a molecular weight of 458.65 g/mol. Its IUPAC name is [3-[8-[4-(4-fluorophenyl)piperazin-1-yl]octoxy]phenyl]thiourea.
| Compound Name | [3-[8-[4-(4-fluorophenyl)piperazin-1-yl]octoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 25126008 |
| Molecular Formula | C25H35FN4OS |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | [3-[8-[4-(4-fluorophenyl)piperazin-1-yl]octoxy]phenyl]thiourea |
| SMILES | NC(=S)Nc1cccc(OCCCCCCCCN2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C25H35FN4OS/c26-21-10-12-23(13-11-21)30-17-15-29(16-18-30)14-5-3-1-2-4-6-19-31-24-9-7-8-22(20-24)28-25(27)32/h7-13,20H,1-6,14-19H2,(H3,27,28,32) |
| InChIKey | HRPBRPHDLVQDLU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|