C20H26N2OS — CID 24798539
[3-(7-phenylheptoxy)phenyl]thiourea (PubChem CID 24798539) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is [3-(7-phenylheptoxy)phenyl]thiourea.
| Compound Name | [3-(7-phenylheptoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 24798539 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [3-(7-phenylheptoxy)phenyl]thiourea |
| SMILES | NC(=S)Nc1cccc(OCCCCCCCc2ccccc2)c1 |
| InChI | InChI=1S/C20H26N2OS/c21-20(24)22-18-13-9-14-19(16-18)23-15-8-3-1-2-5-10-17-11-6-4-7-12-17/h4,6-7,9,11-14,16H,1-3,5,8,10,15H2,(H3,21,22,24) |
| InChIKey | RWDRJBVWLMICOK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|