C21H27BrN4OS2 — CID 25126334
1-(4-bromophenyl)-3-[7-[3-(carbamothioylamino)phenoxy]heptyl]thiourea (PubChem CID 25126334) has the molecular formula C21H27BrN4OS2 and a molecular weight of 495.51 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[7-[3-(carbamothioylamino)phenoxy]heptyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[7-[3-(carbamothioylamino)phenoxy]heptyl]thiourea |
|---|---|
| PubChem CID | 25126334 |
| Molecular Formula | C21H27BrN4OS2 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 1-(4-bromophenyl)-3-[7-[3-(carbamothioylamino)phenoxy]heptyl]thiourea |
| SMILES | NC(=S)Nc1cccc(OCCCCCCCNC(=S)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H27BrN4OS2/c22-16-9-11-17(12-10-16)26-21(29)24-13-4-2-1-3-5-14-27-19-8-6-7-18(15-19)25-20(23)28/h6-12,15H,1-5,13-14H2,(H3,23,25,28)(H2,24,26,29) |
| InChIKey | DBCXFEZYYFEULG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|