C36H41N5OS2 — CID 45485990
1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-[9-(2-phenylethyl)carbazol-3-yl]thiourea (PubChem CID 45485990) has the molecular formula C36H41N5OS2 and a molecular weight of 623.89 g/mol. Its IUPAC name is 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-[9-(2-phenylethyl)carbazol-3-yl]thiourea.
| Compound Name | 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-[9-(2-phenylethyl)carbazol-3-yl]thiourea |
|---|---|
| PubChem CID | 45485990 |
| Molecular Formula | C36H41N5OS2 |
| Molecular Weight | 623.89 g/mol |
| Exact Mass | 623.28 |
| IUPAC Name | 1-[8-[3-(carbamothioylamino)phenoxy]octyl]-3-[9-(2-phenylethyl)carbazol-3-yl]thiourea |
| SMILES | NC(=S)Nc1cccc(OCCCCCCCCNC(=S)Nc2ccc3c(c2)c2ccccc2n3CCc2ccccc2)c1 |
| InChI | InChI=1S/C36H41N5OS2/c37-35(43)39-28-15-12-16-30(25-28)42-24-11-4-2-1-3-10-22-38-36(44)40-29-19-20-34-32(26-29)31-17-8-9-18-33(31)41(34)23-21-27-13-6-5-7-14-27/h5-9,12-20,25-26H,1-4,10-11,21-24H2,(H3,37,39,43)(H2,38,40,44) |
| InChIKey | LXGUTOSCZJGRGB-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.89 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|