C25H27FN2O2S — CID 89275267
[3-[5-[2-[4-(fluoromethyl)phenyl]phenoxy]pentoxy]phenyl]thiourea (PubChem CID 89275267) has the molecular formula C25H27FN2O2S and a molecular weight of 438.57 g/mol. Its IUPAC name is [3-[5-[2-[4-(fluoromethyl)phenyl]phenoxy]pentoxy]phenyl]thiourea.
| Compound Name | [3-[5-[2-[4-(fluoromethyl)phenyl]phenoxy]pentoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 89275267 |
| Molecular Formula | C25H27FN2O2S |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [3-[5-[2-[4-(fluoromethyl)phenyl]phenoxy]pentoxy]phenyl]thiourea |
| SMILES | NC(=S)Nc1cccc(OCCCCCOc2ccccc2-c2ccc(CF)cc2)c1 |
| InChI | InChI=1S/C25H27FN2O2S/c26-18-19-11-13-20(14-12-19)23-9-2-3-10-24(23)30-16-5-1-4-15-29-22-8-6-7-21(17-22)28-25(27)31/h2-3,6-14,17H,1,4-5,15-16,18H2,(H3,27,28,31) |
| InChIKey | HOZRCDLIIWQNBR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|